C18H18BrN3O4 — CID 112828801
1-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-4-(3-nitrophenyl)piperazine (PubChem CID 112828801) has the molecular formula C18H18BrN3O4 and a molecular weight of 420.26 g/mol. Its IUPAC name is 1-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-4-(3-nitrophenyl)piperazine.
| Compound Name | 1-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-4-(3-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 112828801 |
| Molecular Formula | C18H18BrN3O4 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 1-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-4-(3-nitrophenyl)piperazine |
| SMILES | O=[N+]([O-])c1cccc(N2CCN(Cc3cc4c(cc3Br)OCO4)CC2)c1 |
| InChI | InChI=1S/C18H18BrN3O4/c19-16-10-18-17(25-12-26-18)8-13(16)11-20-4-6-21(7-5-20)14-2-1-3-15(9-14)22(23)24/h1-3,8-10H,4-7,11-12H2 |
| InChIKey | PMUNKQOBLGNFME-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|