C19H18ClN5O4S2 — CID 11283016
2-[5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]-1H-indol-3-yl]-N,N-diethyl-2-oxoacetamide (PubChem CID 11283016) has the molecular formula C19H18ClN5O4S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 2-[5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]-1H-indol-3-yl]-N,N-diethyl-2-oxoacetamide.
| Compound Name | 2-[5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]-1H-indol-3-yl]-N,N-diethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 11283016 |
| Molecular Formula | C19H18ClN5O4S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 2-[5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]-1H-indol-3-yl]-N,N-diethyl-2-oxoacetamide |
| SMILES | CCN(CC)C(=O)C(=O)c1c[nH]c2ccc(NS(=O)(=O)c3c(Cl)nc4sccn34)cc12 |
| InChI | InChI=1S/C19H18ClN5O4S2/c1-3-24(4-2)17(27)15(26)13-10-21-14-6-5-11(9-12(13)14)23-31(28,29)18-16(20)22-19-25(18)7-8-30-19/h5-10,21,23H,3-4H2,1-2H3 |
| InChIKey | SBBOTEUDTOUGQK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|