C21H32N4S — CID 112830184
1-[4-butyl-5-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)-1,2,4-triazol-3-yl]-N,N-dimethylpropan-1-amine (PubChem CID 112830184) has the molecular formula C21H32N4S and a molecular weight of 372.58 g/mol. Its IUPAC name is 1-[4-butyl-5-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)-1,2,4-triazol-3-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 1-[4-butyl-5-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)-1,2,4-triazol-3-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 112830184 |
| Molecular Formula | C21H32N4S |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-[4-butyl-5-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)-1,2,4-triazol-3-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CCCCn1c(SC2CCCc3ccccc32)nnc1C(CC)N(C)C |
| InChI | InChI=1S/C21H32N4S/c1-5-7-15-25-20(18(6-2)24(3)4)22-23-21(25)26-19-14-10-12-16-11-8-9-13-17(16)19/h8-9,11,13,18-19H,5-7,10,12,14-15H2,1-4H3 |
| InChIKey | JESHIFAJATZTPE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |