C24H22N4O2S — CID 112830273
4-[3-[[4-(furan-2-ylmethyl)-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzonitrile (PubChem CID 112830273) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-[3-[[4-(furan-2-ylmethyl)-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzonitrile.
| Compound Name | 4-[3-[[4-(furan-2-ylmethyl)-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 112830273 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-[3-[[4-(furan-2-ylmethyl)-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propoxy]benzonitrile |
| SMILES | Cc1ccccc1-c1nnc(SCCCOc2ccc(C#N)cc2)n1Cc1ccco1 |
| InChI | InChI=1S/C24H22N4O2S/c1-18-6-2-3-8-22(18)23-26-27-24(28(23)17-21-7-4-13-30-21)31-15-5-14-29-20-11-9-19(16-25)10-12-20/h2-4,6-13H,5,14-15,17H2,1H3 |
| InChIKey | DSRXHWSVYWQOMU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 76.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|