C25H26N4O3 — CID 112830752
methyl 3-[[6-(N-methylanilino)pyridine-3-carbonyl]amino]-4-pyrrolidin-1-ylbenzoate (PubChem CID 112830752) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is methyl 3-[[6-(N-methylanilino)pyridine-3-carbonyl]amino]-4-pyrrolidin-1-ylbenzoate.
| Compound Name | methyl 3-[[6-(N-methylanilino)pyridine-3-carbonyl]amino]-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 112830752 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | methyl 3-[[6-(N-methylanilino)pyridine-3-carbonyl]amino]-4-pyrrolidin-1-ylbenzoate |
| SMILES | COC(=O)c1ccc(N2CCCC2)c(NC(=O)c2ccc(N(C)c3ccccc3)nc2)c1 |
| InChI | InChI=1S/C25H26N4O3/c1-28(20-8-4-3-5-9-20)23-13-11-19(17-26-23)24(30)27-21-16-18(25(31)32-2)10-12-22(21)29-14-6-7-15-29/h3-5,8-13,16-17H,6-7,14-15H2,1-2H3,(H,27,30) |
| InChIKey | XBNMJOLPQNJCPY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |