C24H23ClN4O5 — CID 11283079
(2R,4S)-1-N-(4-chlorophenyl)-4-ethynyl-4-hydroxy-2-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide (PubChem CID 11283079) has the molecular formula C24H23ClN4O5 and a molecular weight of 482.92 g/mol. Its IUPAC name is (2R,4S)-1-N-(4-chlorophenyl)-4-ethynyl-4-hydroxy-2-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4S)-1-N-(4-chlorophenyl)-4-ethynyl-4-hydroxy-2-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 11283079 |
| Molecular Formula | C24H23ClN4O5 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (2R,4S)-1-N-(4-chlorophenyl)-4-ethynyl-4-hydroxy-2-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide |
| SMILES | C#C[C@@]1(O)C[C@H](C(=O)Nc2ccc(N3CCOCC3=O)cc2)N(C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H23ClN4O5/c1-2-24(33)13-20(29(15-24)23(32)27-18-5-3-16(25)4-6-18)22(31)26-17-7-9-19(10-8-17)28-11-12-34-14-21(28)30/h1,3-10,20,33H,11-15H2,(H,26,31)(H,27,32)/t20-,24-/m1/s1 |
| InChIKey | MILBJTXKGIUCGJ-HYBUGGRVSA-N |
| XLogP | 2.31 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|