C22H25NO2 — CID 11283135
[4-[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]phenyl]methanol (PubChem CID 11283135) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is [4-[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]phenyl]methanol.
| Compound Name | [4-[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]phenyl]methanol |
|---|---|
| PubChem CID | 11283135 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [4-[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]phenyl]methanol |
| SMILES | C[C@@H]1CCCN1CCc1cc2cc(-c3ccc(CO)cc3)ccc2o1 |
| InChI | InChI=1S/C22H25NO2/c1-16-3-2-11-23(16)12-10-21-14-20-13-19(8-9-22(20)25-21)18-6-4-17(15-24)5-7-18/h4-9,13-14,16,24H,2-3,10-12,15H2,1H3/t16-/m1/s1 |
| InChIKey | ZXYGRUFRRCHPAK-MRXNPFEDSA-N |
| XLogP | 4.62 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |