C23H22N2O8S — CID 11283154
methyl 4-(3-hydroxyprop-1-ynyl)-5-(methoxycarbonylamino)-1-methylsulfonyl-7-phenylmethoxyindole-2-carboxylate (PubChem CID 11283154) has the molecular formula C23H22N2O8S and a molecular weight of 486.50 g/mol. Its IUPAC name is methyl 4-(3-hydroxyprop-1-ynyl)-5-(methoxycarbonylamino)-1-methylsulfonyl-7-phenylmethoxyindole-2-carboxylate.
| Compound Name | methyl 4-(3-hydroxyprop-1-ynyl)-5-(methoxycarbonylamino)-1-methylsulfonyl-7-phenylmethoxyindole-2-carboxylate |
|---|---|
| PubChem CID | 11283154 |
| Molecular Formula | C23H22N2O8S |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | methyl 4-(3-hydroxyprop-1-ynyl)-5-(methoxycarbonylamino)-1-methylsulfonyl-7-phenylmethoxyindole-2-carboxylate |
| SMILES | COC(=O)Nc1cc(OCc2ccccc2)c2c(cc(C(=O)OC)n2S(C)(=O)=O)c1C#CCO |
| InChI | InChI=1S/C23H22N2O8S/c1-31-22(27)19-12-17-16(10-7-11-26)18(24-23(28)32-2)13-20(21(17)25(19)34(3,29)30)33-14-15-8-5-4-6-9-15/h4-6,8-9,12-13,26H,11,14H2,1-3H3,(H,24,28) |
| InChIKey | TVSTWDFJNUMZEM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|