C25H25BrN2O4 — CID 112832760
4-[(4-bromophenyl)methoxy]-N-[[4-(ethylcarbamoyl)phenyl]methyl]-3-methoxybenzamide (PubChem CID 112832760) has the molecular formula C25H25BrN2O4 and a molecular weight of 497.39 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methoxy]-N-[[4-(ethylcarbamoyl)phenyl]methyl]-3-methoxybenzamide.
| Compound Name | 4-[(4-bromophenyl)methoxy]-N-[[4-(ethylcarbamoyl)phenyl]methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 112832760 |
| Molecular Formula | C25H25BrN2O4 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 4-[(4-bromophenyl)methoxy]-N-[[4-(ethylcarbamoyl)phenyl]methyl]-3-methoxybenzamide |
| SMILES | CCNC(=O)c1ccc(CNC(=O)c2ccc(OCc3ccc(Br)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H25BrN2O4/c1-3-27-24(29)19-8-4-17(5-9-19)15-28-25(30)20-10-13-22(23(14-20)31-2)32-16-18-6-11-21(26)12-7-18/h4-14H,3,15-16H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | AUCGOPSJZNNUPE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |