About (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone
(4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone (PubChem CID 112833897) has the molecular formula C15H10F2INO
and a molecular weight of 385.15 g/mol. Its IUPAC name is (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone.
Molecular Properties
| Compound Name | (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone |
| PubChem CID | 112833897 |
| Molecular Formula | C15H10F2INO |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone |
| SMILES | O=C(c1ccc(I)cc1)N1CCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C15H10F2INO/c16-10-7-13(17)12-5-6-19(14(12)8-10)15(20)9-1-3-11(18)4-2-9/h1-4,7-8H,5-6H2 |
| InChIKey | GDGUITKLIGFSGT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone?
The IUPAC name of (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone (CID 112833897) is (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone.
What is the SMILES notation for (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone?
The canonical SMILES for (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone is O=C(c1ccc(I)cc1)N1CCc2c(F)cc(F)cc21.
What is the InChIKey of (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone?
The InChIKey is GDGUITKLIGFSGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2INO/c16-10-7-13(17)12-5-6-19(14(12)8-10)15(20)9-1-3-11(18)4-2-9/h1-4,7-8H,5-6H2.
What are the key properties of (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone?
(4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone has a molecular weight of 385.15 g/mol, XLogP of 3.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-difluoro-2,3-dihydroindol-1-yl)-(4-iodophenyl)methanone is sourced from PubChem (CID 112833897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).