C22H28BrN3O3 — CID 112834309
1-(4-bromophenyl)-N-[3-(oxolan-2-ylmethoxy)propyl]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 112834309) has the molecular formula C22H28BrN3O3 and a molecular weight of 462.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[3-(oxolan-2-ylmethoxy)propyl]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[3-(oxolan-2-ylmethoxy)propyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 112834309 |
| Molecular Formula | C22H28BrN3O3 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 1-(4-bromophenyl)-N-[3-(oxolan-2-ylmethoxy)propyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | O=C(NCCCOCC1CCCO1)c1nn(-c2ccc(Br)cc2)c2c1CCCC2 |
| InChI | InChI=1S/C22H28BrN3O3/c23-16-8-10-17(11-9-16)26-20-7-2-1-6-19(20)21(25-26)22(27)24-12-4-13-28-15-18-5-3-14-29-18/h8-11,18H,1-7,12-15H2,(H,24,27) |
| InChIKey | JCNVKHCBFYIJKE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|