C24H27N3O4S — CID 112834645
1-[furan-2-yl(phenyl)methyl]-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]urea (PubChem CID 112834645) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 1-[furan-2-yl(phenyl)methyl]-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]urea.
| Compound Name | 1-[furan-2-yl(phenyl)methyl]-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]urea |
|---|---|
| PubChem CID | 112834645 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 1-[furan-2-yl(phenyl)methyl]-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccccc1S(=O)(=O)N1CCCCC1)NC(c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C24H27N3O4S/c28-24(26-23(21-13-9-17-31-21)19-10-3-1-4-11-19)25-18-20-12-5-6-14-22(20)32(29,30)27-15-7-2-8-16-27/h1,3-6,9-14,17,23H,2,7-8,15-16,18H2,(H2,25,26,28) |
| InChIKey | KKXCBQMXIHKJNT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |