C21H34N4O — CID 112835433
1-methyl-1-(3-methylcyclohexyl)-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]urea (PubChem CID 112835433) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-methyl-1-(3-methylcyclohexyl)-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]urea.
| Compound Name | 1-methyl-1-(3-methylcyclohexyl)-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 112835433 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 1-methyl-1-(3-methylcyclohexyl)-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]urea |
| SMILES | CC1CCN(c2ccc(CNC(=O)N(C)C3CCCC(C)C3)cn2)CC1 |
| InChI | InChI=1S/C21H34N4O/c1-16-9-11-25(12-10-16)20-8-7-18(14-22-20)15-23-21(26)24(3)19-6-4-5-17(2)13-19/h7-8,14,16-17,19H,4-6,9-13,15H2,1-3H3,(H,23,26) |
| InChIKey | MVPXQTYQIVPUJG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |