C30H31N3O2 — CID 112835490
N-butan-2-yl-3-[[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]methyl]benzamide (PubChem CID 112835490) has the molecular formula C30H31N3O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 112835490 |
| Molecular Formula | C30H31N3O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | N-butan-2-yl-3-[[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CNC(=O)Cc2c(C)nc3ccccc3c2-c2ccccc2)c1 |
| InChI | InChI=1S/C30H31N3O2/c1-4-20(2)32-30(35)24-14-10-11-22(17-24)19-31-28(34)18-26-21(3)33-27-16-9-8-15-25(27)29(26)23-12-6-5-7-13-23/h5-17,20H,4,18-19H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | WAJUFQAMAKIQAT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |