C27H30ClN3O5 — CID 11283653
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(imidazo[1,2-a]pyrimidin-2-ylmethyl)oxane-2,4-dione (PubChem CID 11283653) has the molecular formula C27H30ClN3O5 and a molecular weight of 512.01 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(imidazo[1,2-a]pyrimidin-2-ylmethyl)oxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(imidazo[1,2-a]pyrimidin-2-ylmethyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 11283653 |
| Molecular Formula | C27H30ClN3O5 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(imidazo[1,2-a]pyrimidin-2-ylmethyl)oxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Cc3cn4cccnc4n3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C27H30ClN3O5/c1-34-23-14-24(35-2)21(28)12-17(23)8-9-27(18-6-3-4-7-18)15-22(32)20(25(33)36-27)13-19-16-31-11-5-10-29-26(31)30-19/h5,10-12,14,16,18,20H,3-4,6-9,13,15H2,1-2H3 |
| InChIKey | QBZHMVZEGGEEEH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|