About N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide
N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide (PubChem CID 112837365) has the molecular formula C22H24N2OS
and a molecular weight of 364.51 g/mol. Its IUPAC name is N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 112837365 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)c(C(=O)N(C)CCCCc2ccccc2)s1 |
| InChI | InChI=1S/C22H24N2OS/c1-17-23-20(19-14-7-4-8-15-19)21(26-17)22(25)24(2)16-10-9-13-18-11-5-3-6-12-18/h3-8,11-12,14-15H,9-10,13,16H2,1-2H3 |
| InChIKey | WKMNDLFDBYEKBE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide (CID 112837365) is N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide is Cc1nc(-c2ccccc2)c(C(=O)N(C)CCCCc2ccccc2)s1.
What is the InChIKey of N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide?
The InChIKey is WKMNDLFDBYEKBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2OS/c1-17-23-20(19-14-7-4-8-15-19)21(26-17)22(25)24(2)16-10-9-13-18-11-5-3-6-12-18/h3-8,11-12,14-15H,9-10,13,16H2,1-2H3.
What are the key properties of N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide?
N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide has a molecular weight of 364.51 g/mol, XLogP of 5.21, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-4-phenyl-N-(4-phenylbutyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 112837365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).