C22H27NO3 — CID 112837372
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-N-(4-phenylbutyl)propanamide (PubChem CID 112837372) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-N-(4-phenylbutyl)propanamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-N-(4-phenylbutyl)propanamide |
|---|---|
| PubChem CID | 112837372 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-N-(4-phenylbutyl)propanamide |
| SMILES | CN(CCCCc1ccccc1)C(=O)CCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H27NO3/c1-23(14-6-5-9-18-7-3-2-4-8-18)22(24)13-11-19-10-12-20-21(17-19)26-16-15-25-20/h2-4,7-8,10,12,17H,5-6,9,11,13-16H2,1H3 |
| InChIKey | KKRULVXCLUUBHD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|