C22H22F3N3O — CID 112837815
1-[3-(2-phenylethynyl)phenyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]urea (PubChem CID 112837815) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is 1-[3-(2-phenylethynyl)phenyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-[3-(2-phenylethynyl)phenyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 112837815 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[3-(2-phenylethynyl)phenyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]urea |
| SMILES | O=C(NCC1CCN(CC(F)(F)F)C1)Nc1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H22F3N3O/c23-22(24,25)16-28-12-11-19(15-28)14-26-21(29)27-20-8-4-7-18(13-20)10-9-17-5-2-1-3-6-17/h1-8,13,19H,11-12,14-16H2,(H2,26,27,29) |
| InChIKey | WJWDUMOXORABOA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|