C25H27N3O3 — CID 112838540
N-ethyl-2-[4-[(2-hydroxy-2-phenylethyl)carbamoylamino]phenyl]-N-phenylacetamide (PubChem CID 112838540) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-ethyl-2-[4-[(2-hydroxy-2-phenylethyl)carbamoylamino]phenyl]-N-phenylacetamide.
| Compound Name | N-ethyl-2-[4-[(2-hydroxy-2-phenylethyl)carbamoylamino]phenyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 112838540 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-ethyl-2-[4-[(2-hydroxy-2-phenylethyl)carbamoylamino]phenyl]-N-phenylacetamide |
| SMILES | CCN(C(=O)Cc1ccc(NC(=O)NCC(O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O3/c1-2-28(22-11-7-4-8-12-22)24(30)17-19-13-15-21(16-14-19)27-25(31)26-18-23(29)20-9-5-3-6-10-20/h3-16,23,29H,2,17-18H2,1H3,(H2,26,27,31) |
| InChIKey | OEXJMSKNGFVQGF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |