C23H20ClN3O4 — CID 112839439
1-[5-[[4-(4-chloro-2-nitrophenoxy)phenyl]methylamino]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 112839439) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is 1-[5-[[4-(4-chloro-2-nitrophenoxy)phenyl]methylamino]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-[[4-(4-chloro-2-nitrophenoxy)phenyl]methylamino]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 112839439 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-[5-[[4-(4-chloro-2-nitrophenoxy)phenyl]methylamino]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(NCc3ccc(Oc4ccc(Cl)cc4[N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C23H20ClN3O4/c1-15(28)26-11-10-17-12-19(5-8-21(17)26)25-14-16-2-6-20(7-3-16)31-23-9-4-18(24)13-22(23)27(29)30/h2-9,12-13,25H,10-11,14H2,1H3 |
| InChIKey | OBIDZIWRJZACIN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|