C28H50O6Si2 — CID 11284099
tert-butyl-[(2E,6R,7R,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1,12-bis(methoxymethoxy)dodeca-2,10-dien-4,8-diyn-6-yl]oxy-dimethylsilane (PubChem CID 11284099) has the molecular formula C28H50O6Si2 and a molecular weight of 538.87 g/mol. Its IUPAC name is tert-butyl-[(2E,6R,7R,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1,12-bis(methoxymethoxy)dodeca-2,10-dien-4,8-diyn-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6R,7R,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1,12-bis(methoxymethoxy)dodeca-2,10-dien-4,8-diyn-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11284099 |
| Molecular Formula | C28H50O6Si2 |
| Molecular Weight | 538.87 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | tert-butyl-[(2E,6R,7R,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1,12-bis(methoxymethoxy)dodeca-2,10-dien-4,8-diyn-6-yl]oxy-dimethylsilane |
| SMILES | COCOC/C=C/C#C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C#C/C=C/COCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O6Si2/c1-27(2,3)35(9,10)33-25(19-15-13-17-21-31-23-29-7)26(34-36(11,12)28(4,5)6)20-16-14-18-22-32-24-30-8/h13-14,17-18,25-26H,21-24H2,1-12H3/b17-13+,18-14+/t25-,26-/m1/s1 |
| InChIKey | BYUPJKYTJIKPSU-KBYABHGMSA-N |
| XLogP | 6.13 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.87 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|