C20H20ClN3OS — CID 112842058
N-[1-(4-chlorophenyl)ethyl]-N-methyl-2-(2-methylquinazolin-4-yl)sulfanylacetamide (PubChem CID 112842058) has the molecular formula C20H20ClN3OS and a molecular weight of 385.92 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-N-methyl-2-(2-methylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-N-methyl-2-(2-methylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 112842058 |
| Molecular Formula | C20H20ClN3OS |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-N-methyl-2-(2-methylquinazolin-4-yl)sulfanylacetamide |
| SMILES | Cc1nc(SCC(=O)N(C)C(C)c2ccc(Cl)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C20H20ClN3OS/c1-13(15-8-10-16(21)11-9-15)24(3)19(25)12-26-20-17-6-4-5-7-18(17)22-14(2)23-20/h4-11,13H,12H2,1-3H3 |
| InChIKey | GSJTVGRLXYXZRN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |