C21H26N6O2S — CID 112842093
4,5,6,7-tetrahydro-1H-indazol-3-yl-[4-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propyl]piperazin-1-yl]methanone (PubChem CID 112842093) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1H-indazol-3-yl-[4-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propyl]piperazin-1-yl]methanone.
| Compound Name | 4,5,6,7-tetrahydro-1H-indazol-3-yl-[4-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 112842093 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4,5,6,7-tetrahydro-1H-indazol-3-yl-[4-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1n[nH]c2c1CCCC2)N1CCN(CCCc2nc(-c3cccs3)no2)CC1 |
| InChI | InChI=1S/C21H26N6O2S/c28-21(19-15-5-1-2-6-16(15)23-24-19)27-12-10-26(11-13-27)9-3-8-18-22-20(25-29-18)17-7-4-14-30-17/h4,7,14H,1-3,5-6,8-13H2,(H,23,24) |
| InChIKey | KOSYLGXVGOLMBU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |