C16H13Cl3N2O4 — CID 112842248
N-[4-(3-amino-3-oxopropoxy)phenyl]-2,3,5-trichloro-6-hydroxybenzamide (PubChem CID 112842248) has the molecular formula C16H13Cl3N2O4 and a molecular weight of 403.65 g/mol. Its IUPAC name is N-[4-(3-amino-3-oxopropoxy)phenyl]-2,3,5-trichloro-6-hydroxybenzamide.
| Compound Name | N-[4-(3-amino-3-oxopropoxy)phenyl]-2,3,5-trichloro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 112842248 |
| Molecular Formula | C16H13Cl3N2O4 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | N-[4-(3-amino-3-oxopropoxy)phenyl]-2,3,5-trichloro-6-hydroxybenzamide |
| SMILES | NC(=O)CCOc1ccc(NC(=O)c2c(O)c(Cl)cc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H13Cl3N2O4/c17-10-7-11(18)15(23)13(14(10)19)16(24)21-8-1-3-9(4-2-8)25-6-5-12(20)22/h1-4,7,23H,5-6H2,(H2,20,22)(H,21,24) |
| InChIKey | TXPPOLVWFFSMDO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|