C29H22F2N2O5S — CID 11284236
(5E)-5-[1-[4-[2-[6-fluoro-2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11284236) has the molecular formula C29H22F2N2O5S and a molecular weight of 548.57 g/mol. Its IUPAC name is (5E)-5-[1-[4-[2-[6-fluoro-2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[1-[4-[2-[6-fluoro-2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11284236 |
| Molecular Formula | C29H22F2N2O5S |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | (5E)-5-[1-[4-[2-[6-fluoro-2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C/C(=C1\SC(=O)NC1=O)c1ccc(OCCOc2c(-c3ccc(F)cc3)n(C)c3ccc(F)cc3c2=O)cc1 |
| InChI | InChI=1S/C29H22F2N2O5S/c1-16(27-28(35)32-29(36)39-27)17-5-10-21(11-6-17)37-13-14-38-26-24(18-3-7-19(30)8-4-18)33(2)23-12-9-20(31)15-22(23)25(26)34/h3-12,15H,13-14H2,1-2H3,(H,32,35,36)/b27-16+ |
| InChIKey | AJSIHQRHIYSNDL-JVWAILMASA-N |
| XLogP | 5.66 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|