C19H27F3N4O2S — CID 112842852
3-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one (PubChem CID 112842852) has the molecular formula C19H27F3N4O2S and a molecular weight of 432.51 g/mol. Its IUPAC name is 3-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one.
| Compound Name | 3-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one |
|---|---|
| PubChem CID | 112842852 |
| Molecular Formula | C19H27F3N4O2S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one |
| SMILES | CC(C)(C)c1nc(CN2CCN(C(=O)C3CCC(C(F)(F)F)NC3=O)CC2)cs1 |
| InChI | InChI=1S/C19H27F3N4O2S/c1-18(2,3)17-23-12(11-29-17)10-25-6-8-26(9-7-25)16(28)13-4-5-14(19(20,21)22)24-15(13)27/h11,13-14H,4-10H2,1-3H3,(H,24,27) |
| InChIKey | MWAYBQDEFDMIGB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|