C24H38N4O7S2 — CID 11284377
(1S,4R,7R,11S,12E,21S)-21-[(1R)-1-hydroxyethyl]-4,7-di(propan-2-yl)-23-oxa-16,17-dithia-2,5,8,20-tetrazabicyclo[9.7.5]tricos-12-ene-3,6,9,19,22-pentone (PubChem CID 11284377) has the molecular formula C24H38N4O7S2 and a molecular weight of 558.72 g/mol. Its IUPAC name is (1S,4R,7R,11S,12E,21S)-21-[(1R)-1-hydroxyethyl]-4,7-di(propan-2-yl)-23-oxa-16,17-dithia-2,5,8,20-tetrazabicyclo[9.7.5]tricos-12-ene-3,6,9,19,22-pentone.
| Compound Name | (1S,4R,7R,11S,12E,21S)-21-[(1R)-1-hydroxyethyl]-4,7-di(propan-2-yl)-23-oxa-16,17-dithia-2,5,8,20-tetrazabicyclo[9.7.5]tricos-12-ene-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 11284377 |
| Molecular Formula | C24H38N4O7S2 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | (1S,4R,7R,11S,12E,21S)-21-[(1R)-1-hydroxyethyl]-4,7-di(propan-2-yl)-23-oxa-16,17-dithia-2,5,8,20-tetrazabicyclo[9.7.5]tricos-12-ene-3,6,9,19,22-pentone |
| SMILES | CC(C)[C@H]1NC(=O)C[C@H]2/C=C/CCSSC[C@@H](NC(=O)[C@@H](C(C)C)NC1=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)O2 |
| InChI | InChI=1S/C24H38N4O7S2/c1-12(2)18-23(33)27-19(13(3)4)22(32)25-16-11-37-36-9-7-6-8-15(10-17(30)26-18)35-24(34)20(14(5)29)28-21(16)31/h6,8,12-16,18-20,29H,7,9-11H2,1-5H3,(H,25,32)(H,26,30)(H,27,33)(H,28,31)/b8-6+/t14-,15-,16-,18-,19-,20+/m1/s1 |
| InChIKey | GDLZUXCKQAPAFR-XJEFWCHZSA-N |
| XLogP | 0.28 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|