C35H41ClO4 — CID 11284398
2-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-hydroxymethyl]-3-chloro-4,5-bis(phenylmethoxy)phenol (PubChem CID 11284398) has the molecular formula C35H41ClO4 and a molecular weight of 561.16 g/mol. Its IUPAC name is 2-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-hydroxymethyl]-3-chloro-4,5-bis(phenylmethoxy)phenol.
| Compound Name | 2-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-hydroxymethyl]-3-chloro-4,5-bis(phenylmethoxy)phenol |
|---|---|
| PubChem CID | 11284398 |
| Molecular Formula | C35H41ClO4 |
| Molecular Weight | 561.16 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 2-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-hydroxymethyl]-3-chloro-4,5-bis(phenylmethoxy)phenol |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C(O)c1c(O)cc(OCc2ccccc2)c(OCc2ccccc2)c1Cl |
| InChI | InChI=1S/C35H41ClO4/c1-23-16-17-28-34(2,3)18-11-19-35(28,4)30(23)32(38)29-26(37)20-27(39-21-24-12-7-5-8-13-24)33(31(29)36)40-22-25-14-9-6-10-15-25/h5-10,12-15,20,28,30,32,37-38H,1,11,16-19,21-22H2,2-4H3/t28-,30+,32?,35-/m0/s1 |
| InChIKey | UQUZLRCKWAKNKL-XKDIABPYSA-N |
| XLogP | 9.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.16 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|