C24H23N3O5S — CID 112845926
3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-N-[1-(3-nitrophenyl)ethyl]benzamide (PubChem CID 112845926) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-N-[1-(3-nitrophenyl)ethyl]benzamide.
| Compound Name | 3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-N-[1-(3-nitrophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 112845926 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 3-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-N-[1-(3-nitrophenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cccc(S(=O)(=O)N2c3ccccc3CC2C)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23N3O5S/c1-16-13-19-7-3-4-12-23(19)26(16)33(31,32)22-11-6-9-20(15-22)24(28)25-17(2)18-8-5-10-21(14-18)27(29)30/h3-12,14-17H,13H2,1-2H3,(H,25,28) |
| InChIKey | GEJJIQDNYFMVCL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|