C19H25N5O2 — CID 112846868
6-(3-acetamidoanilino)-2-methyl-N-pentylpyrimidine-4-carboxamide (PubChem CID 112846868) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 6-(3-acetamidoanilino)-2-methyl-N-pentylpyrimidine-4-carboxamide.
| Compound Name | 6-(3-acetamidoanilino)-2-methyl-N-pentylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112846868 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 6-(3-acetamidoanilino)-2-methyl-N-pentylpyrimidine-4-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(Nc2cccc(NC(C)=O)c2)nc(C)n1 |
| InChI | InChI=1S/C19H25N5O2/c1-4-5-6-10-20-19(26)17-12-18(22-13(2)21-17)24-16-9-7-8-15(11-16)23-14(3)25/h7-9,11-12H,4-6,10H2,1-3H3,(H,20,26)(H,23,25)(H,21,22,24) |
| InChIKey | CGCOOYNSICCJRO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|