C29H30N4O6 — CID 11284767
ethyl (3S)-3-[[2-[(4-carbamimidoylphenyl)methoxy]-4-methyl-3-oxo-1,4-benzoxazine-7-carbonyl]amino]-3-phenylpropanoate (PubChem CID 11284767) has the molecular formula C29H30N4O6 and a molecular weight of 530.58 g/mol. Its IUPAC name is ethyl (3S)-3-[[2-[(4-carbamimidoylphenyl)methoxy]-4-methyl-3-oxo-1,4-benzoxazine-7-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (3S)-3-[[2-[(4-carbamimidoylphenyl)methoxy]-4-methyl-3-oxo-1,4-benzoxazine-7-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11284767 |
| Molecular Formula | C29H30N4O6 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | ethyl (3S)-3-[[2-[(4-carbamimidoylphenyl)methoxy]-4-methyl-3-oxo-1,4-benzoxazine-7-carbonyl]amino]-3-phenylpropanoate |
| SMILES | [H]/N=C(\N)c1ccc(COC2Oc3cc(C(=O)N[C@@H](CC(=O)OCC)c4ccccc4)ccc3N(C)C2=O)cc1 |
| InChI | InChI=1S/C29H30N4O6/c1-3-37-25(34)16-22(19-7-5-4-6-8-19)32-27(35)21-13-14-23-24(15-21)39-29(28(36)33(23)2)38-17-18-9-11-20(12-10-18)26(30)31/h4-15,22,29H,3,16-17H2,1-2H3,(H3,30,31)(H,32,35)/t22-,29?/m0/s1 |
| InChIKey | OCZVFIOUSILBIJ-RBQQCVMASA-N |
| XLogP | 3.29 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|