C20H26N4O — CID 112847771
azepan-1-yl-[6-(3,4-dimethylanilino)-2-methylpyrimidin-4-yl]methanone (PubChem CID 112847771) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is azepan-1-yl-[6-(3,4-dimethylanilino)-2-methylpyrimidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[6-(3,4-dimethylanilino)-2-methylpyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 112847771 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | azepan-1-yl-[6-(3,4-dimethylanilino)-2-methylpyrimidin-4-yl]methanone |
| SMILES | Cc1nc(Nc2ccc(C)c(C)c2)cc(C(=O)N2CCCCCC2)n1 |
| InChI | InChI=1S/C20H26N4O/c1-14-8-9-17(12-15(14)2)23-19-13-18(21-16(3)22-19)20(25)24-10-6-4-5-7-11-24/h8-9,12-13H,4-7,10-11H2,1-3H3,(H,21,22,23) |
| InChIKey | OYHVOMQEBCRNCP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |