C20H20N4O2 — CID 112848508
N-(4-methoxyphenyl)-2-methyl-6-(N-methylanilino)pyrimidine-4-carboxamide (PubChem CID 112848508) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-methyl-6-(N-methylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2-methyl-6-(N-methylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112848508 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(4-methoxyphenyl)-2-methyl-6-(N-methylanilino)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(N(C)c3ccccc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-14-21-18(20(25)23-15-9-11-17(26-3)12-10-15)13-19(22-14)24(2)16-7-5-4-6-8-16/h4-13H,1-3H3,(H,23,25) |
| InChIKey | LWSVRJXVFGHZAZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |