C15H8ClF17N2S — CID 11284923
2-chloro-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-6-methylpyrimidine (PubChem CID 11284923) has the molecular formula C15H8ClF17N2S and a molecular weight of 606.73 g/mol. Its IUPAC name is 2-chloro-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-6-methylpyrimidine.
| Compound Name | 2-chloro-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-6-methylpyrimidine |
|---|---|
| PubChem CID | 11284923 |
| Molecular Formula | C15H8ClF17N2S |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 605.98 |
| IUPAC Name | 2-chloro-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)-6-methylpyrimidine |
| SMILES | Cc1cc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C15H8ClF17N2S/c1-5-4-6(35-7(16)34-5)36-3-2-8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)15(31,32)33/h4H,2-3H2,1H3 |
| InChIKey | KOWRKYMILGTGNS-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|