C21H18N6O2 — CID 112850860
N-(3-acetamidophenyl)-6-(2-cyanoanilino)-2-methylpyrimidine-4-carboxamide (PubChem CID 112850860) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-6-(2-cyanoanilino)-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-(3-acetamidophenyl)-6-(2-cyanoanilino)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112850860 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(3-acetamidophenyl)-6-(2-cyanoanilino)-2-methylpyrimidine-4-carboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2cc(Nc3ccccc3C#N)nc(C)n2)c1 |
| InChI | InChI=1S/C21H18N6O2/c1-13-23-19(11-20(24-13)27-18-9-4-3-6-15(18)12-22)21(29)26-17-8-5-7-16(10-17)25-14(2)28/h3-11H,1-2H3,(H,25,28)(H,26,29)(H,23,24,27) |
| InChIKey | WPRXMTDJYWXWME-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |