C36H48N8O3 — CID 11285141
1-[4-(1,4-diazepan-1-yl)piperidin-1-yl]-2-(1H-indazol-5-ylmethyl)-4-[4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)piperidin-1-yl]butane-1,4-dione (PubChem CID 11285141) has the molecular formula C36H48N8O3 and a molecular weight of 640.83 g/mol. Its IUPAC name is 1-[4-(1,4-diazepan-1-yl)piperidin-1-yl]-2-(1H-indazol-5-ylmethyl)-4-[4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)piperidin-1-yl]butane-1,4-dione.
| Compound Name | 1-[4-(1,4-diazepan-1-yl)piperidin-1-yl]-2-(1H-indazol-5-ylmethyl)-4-[4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)piperidin-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 11285141 |
| Molecular Formula | C36H48N8O3 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | 1-[4-(1,4-diazepan-1-yl)piperidin-1-yl]-2-(1H-indazol-5-ylmethyl)-4-[4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)piperidin-1-yl]butane-1,4-dione |
| SMILES | O=C(CC(Cc1ccc2[nH]ncc2c1)C(=O)N1CCC(N2CCCNCC2)CC1)N1CCC(N2CCc3ccccc3NC2=O)CC1 |
| InChI | InChI=1S/C36H48N8O3/c45-34(42-16-11-31(12-17-42)44-20-8-27-4-1-2-5-32(27)39-36(44)47)24-28(22-26-6-7-33-29(23-26)25-38-40-33)35(46)43-18-9-30(10-19-43)41-15-3-13-37-14-21-41/h1-2,4-7,23,25,28,30-31,37H,3,8-22,24H2,(H,38,40)(H,39,47) |
| InChIKey | IYOUDBOSUPHKQI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |