C36H38FNO9 — CID 11285199
(4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[4-[3-[(1S,2R,3R,4R,5S)-1,2,3,4,5,6-hexahydroxyhexyl]phenyl]-2-hydroxyphenyl]-1-phenylazetidin-2-one (PubChem CID 11285199) has the molecular formula C36H38FNO9 and a molecular weight of 647.70 g/mol. Its IUPAC name is (4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[4-[3-[(1S,2R,3R,4R,5S)-1,2,3,4,5,6-hexahydroxyhexyl]phenyl]-2-hydroxyphenyl]-1-phenylazetidin-2-one.
| Compound Name | (4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[4-[3-[(1S,2R,3R,4R,5S)-1,2,3,4,5,6-hexahydroxyhexyl]phenyl]-2-hydroxyphenyl]-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 11285199 |
| Molecular Formula | C36H38FNO9 |
| Molecular Weight | 647.70 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | (4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-[4-[3-[(1S,2R,3R,4R,5S)-1,2,3,4,5,6-hexahydroxyhexyl]phenyl]-2-hydroxyphenyl]-1-phenylazetidin-2-one |
| SMILES | O=C1C(CC[C@H](O)c2ccc(F)cc2)[C@@H](c2ccc(-c3cccc([C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO)c3)cc2O)N1c1ccccc1 |
| InChI | InChI=1S/C36H38FNO9/c37-24-12-9-20(10-13-24)28(40)16-15-27-31(38(36(27)47)25-7-2-1-3-8-25)26-14-11-22(18-29(26)41)21-5-4-6-23(17-21)32(43)34(45)35(46)33(44)30(42)19-39/h1-14,17-18,27-28,30-35,39-46H,15-16,19H2/t27?,28-,30-,31+,32-,33+,34+,35-/m0/s1 |
| InChIKey | APDKZQRCHXCGTQ-MRIRXBNPSA-N |
| XLogP | 2.89 |
| TPSA | 182.15 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|