C24H23N5O — CID 112852272
6-(butylamino)-2-phenyl-N-quinolin-8-ylpyrimidine-4-carboxamide (PubChem CID 112852272) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 6-(butylamino)-2-phenyl-N-quinolin-8-ylpyrimidine-4-carboxamide.
| Compound Name | 6-(butylamino)-2-phenyl-N-quinolin-8-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112852272 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 6-(butylamino)-2-phenyl-N-quinolin-8-ylpyrimidine-4-carboxamide |
| SMILES | CCCCNc1cc(C(=O)Nc2cccc3cccnc23)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H23N5O/c1-2-3-14-25-21-16-20(27-23(29-21)18-9-5-4-6-10-18)24(30)28-19-13-7-11-17-12-8-15-26-22(17)19/h4-13,15-16H,2-3,14H2,1H3,(H,28,30)(H,25,27,29) |
| InChIKey | IISLKVLUDODQAE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|