C23H27N5O — CID 112852404
N-[4-(dimethylamino)phenyl]-6-(2-methylpropylamino)-2-phenylpyrimidine-4-carboxamide (PubChem CID 112852404) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-6-(2-methylpropylamino)-2-phenylpyrimidine-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-6-(2-methylpropylamino)-2-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112852404 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-6-(2-methylpropylamino)-2-phenylpyrimidine-4-carboxamide |
| SMILES | CC(C)CNc1cc(C(=O)Nc2ccc(N(C)C)cc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H27N5O/c1-16(2)15-24-21-14-20(26-22(27-21)17-8-6-5-7-9-17)23(29)25-18-10-12-19(13-11-18)28(3)4/h5-14,16H,15H2,1-4H3,(H,25,29)(H,24,26,27) |
| InChIKey | AXMVEIHWQLDIHQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|