C24H26N4O — CID 112852816
6-(cyclopentylamino)-2-phenyl-N-(2-phenylethyl)pyrimidine-4-carboxamide (PubChem CID 112852816) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 6-(cyclopentylamino)-2-phenyl-N-(2-phenylethyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(cyclopentylamino)-2-phenyl-N-(2-phenylethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112852816 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 6-(cyclopentylamino)-2-phenyl-N-(2-phenylethyl)pyrimidine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cc(NC2CCCC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H26N4O/c29-24(25-16-15-18-9-3-1-4-10-18)21-17-22(26-20-13-7-8-14-20)28-23(27-21)19-11-5-2-6-12-19/h1-6,9-12,17,20H,7-8,13-16H2,(H,25,29)(H,26,27,28) |
| InChIKey | DUCRUARCNJUCCU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |