C19H20N4O3 — CID 112853104
N-(furan-2-ylmethyl)-6-(2-methoxyethylamino)-2-phenylpyrimidine-4-carboxamide (PubChem CID 112853104) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-6-(2-methoxyethylamino)-2-phenylpyrimidine-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-6-(2-methoxyethylamino)-2-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112853104 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-6-(2-methoxyethylamino)-2-phenylpyrimidine-4-carboxamide |
| SMILES | COCCNc1cc(C(=O)NCc2ccco2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H20N4O3/c1-25-11-9-20-17-12-16(19(24)21-13-15-8-5-10-26-15)22-18(23-17)14-6-3-2-4-7-14/h2-8,10,12H,9,11,13H2,1H3,(H,21,24)(H,20,22,23) |
| InChIKey | OFSGODCVHXFYPF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|