C28H22N2O8S5 — CID 11285352
dimethyl 2-[[3-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-6,7-dimethylthieno[3,4-b]quinoxalin-1-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11285352) has the molecular formula C28H22N2O8S5 and a molecular weight of 674.82 g/mol. Its IUPAC name is dimethyl 2-[[3-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-6,7-dimethylthieno[3,4-b]quinoxalin-1-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[[3-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-6,7-dimethylthieno[3,4-b]quinoxalin-1-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11285352 |
| Molecular Formula | C28H22N2O8S5 |
| Molecular Weight | 674.82 g/mol |
| Exact Mass | 674.00 |
| IUPAC Name | dimethyl 2-[[3-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-6,7-dimethylthieno[3,4-b]quinoxalin-1-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=Cc2sc(C=C3SC(C(=O)OC)=C(C(=O)OC)S3)c3nc4cc(C)c(C)cc4nc23)S1 |
| InChI | InChI=1S/C28H22N2O8S5/c1-11-7-13-14(8-12(11)2)30-20-16(10-18-42-23(27(33)37-5)24(43-18)28(34)38-6)39-15(19(20)29-13)9-17-40-21(25(31)35-3)22(41-17)26(32)36-4/h7-10H,1-6H3 |
| InChIKey | QKUSGGZAUMXLMK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.82 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|