C22H25N5O — CID 112853682
N-[2-(dimethylamino)ethyl]-6-(2-methylanilino)-2-phenylpyrimidine-4-carboxamide (PubChem CID 112853682) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-6-(2-methylanilino)-2-phenylpyrimidine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-6-(2-methylanilino)-2-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112853682 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-6-(2-methylanilino)-2-phenylpyrimidine-4-carboxamide |
| SMILES | Cc1ccccc1Nc1cc(C(=O)NCCN(C)C)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H25N5O/c1-16-9-7-8-12-18(16)24-20-15-19(22(28)23-13-14-27(2)3)25-21(26-20)17-10-5-4-6-11-17/h4-12,15H,13-14H2,1-3H3,(H,23,28)(H,24,25,26) |
| InChIKey | YBVXQYHBGYPNGT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |