C23H24N4O — CID 112854327
N-tert-butyl-6-(2,3-dihydroindol-1-yl)-2-phenylpyrimidine-4-carboxamide (PubChem CID 112854327) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is N-tert-butyl-6-(2,3-dihydroindol-1-yl)-2-phenylpyrimidine-4-carboxamide.
| Compound Name | N-tert-butyl-6-(2,3-dihydroindol-1-yl)-2-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112854327 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-tert-butyl-6-(2,3-dihydroindol-1-yl)-2-phenylpyrimidine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cc(N2CCc3ccccc32)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H24N4O/c1-23(2,3)26-22(28)18-15-20(25-21(24-18)17-10-5-4-6-11-17)27-14-13-16-9-7-8-12-19(16)27/h4-12,15H,13-14H2,1-3H3,(H,26,28) |
| InChIKey | SNHLVEGAYVTTLJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |