C16H21N5 — CID 112855770
4-N,4-N-dimethyl-1-N-(6-pyrrolidin-1-ylpyrimidin-4-yl)benzene-1,4-diamine (PubChem CID 112855770) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-(6-pyrrolidin-1-ylpyrimidin-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-(6-pyrrolidin-1-ylpyrimidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 112855770 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-(6-pyrrolidin-1-ylpyrimidin-4-yl)benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2cc(N3CCCC3)ncn2)cc1 |
| InChI | InChI=1S/C16H21N5/c1-20(2)14-7-5-13(6-8-14)19-15-11-16(18-12-17-15)21-9-3-4-10-21/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,17,18,19) |
| InChIKey | QCGTXOLZBNDNPZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|