C33H34Cl2N6O4 — CID 11285709
(2S,5S,8R,12S)-12-amino-5-benzyl-8-[(3,4-dichlorophenyl)methyl]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone (PubChem CID 11285709) has the molecular formula C33H34Cl2N6O4 and a molecular weight of 649.58 g/mol. Its IUPAC name is (2S,5S,8R,12S)-12-amino-5-benzyl-8-[(3,4-dichlorophenyl)methyl]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone.
| Compound Name | (2S,5S,8R,12S)-12-amino-5-benzyl-8-[(3,4-dichlorophenyl)methyl]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
|---|---|
| PubChem CID | 11285709 |
| Molecular Formula | C33H34Cl2N6O4 |
| Molecular Weight | 649.58 g/mol |
| Exact Mass | 648.20 |
| IUPAC Name | (2S,5S,8R,12S)-12-amino-5-benzyl-8-[(3,4-dichlorophenyl)methyl]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
| SMILES | N[C@H]1CC(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](Cc2ccc(Cl)c(Cl)c2)CNC1=O |
| InChI | InChI=1S/C33H34Cl2N6O4/c34-24-11-10-20(13-25(24)35)12-22-18-38-31(43)26(36)16-30(42)40-29(15-21-17-37-27-9-5-4-8-23(21)27)33(45)41-28(32(44)39-22)14-19-6-2-1-3-7-19/h1-11,13,17,22,26,28-29,37H,12,14-16,18,36H2,(H,38,43)(H,39,44)(H,40,42)(H,41,45)/t22-,26+,28+,29+/m1/s1 |
| InChIKey | PMVVNMAFMROGBJ-ACVDBWASSA-N |
| XLogP | 2.80 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |