C17H25N5O — CID 112857735
6-N-[3-(dimethylamino)propyl]-4-N-[(4-methoxyphenyl)methyl]pyrimidine-4,6-diamine (PubChem CID 112857735) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 6-N-[3-(dimethylamino)propyl]-4-N-[(4-methoxyphenyl)methyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-[3-(dimethylamino)propyl]-4-N-[(4-methoxyphenyl)methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112857735 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 6-N-[3-(dimethylamino)propyl]-4-N-[(4-methoxyphenyl)methyl]pyrimidine-4,6-diamine |
| SMILES | COc1ccc(CNc2cc(NCCCN(C)C)ncn2)cc1 |
| InChI | InChI=1S/C17H25N5O/c1-22(2)10-4-9-18-16-11-17(21-13-20-16)19-12-14-5-7-15(23-3)8-6-14/h5-8,11,13H,4,9-10,12H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | FPHNPABXBQPPGV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|