C15H27N5O2S — CID 112857759
6-N-[3-(dimethylamino)propyl]-4-N-(1,1-dioxothiolan-3-yl)-4-N-ethylpyrimidine-4,6-diamine (PubChem CID 112857759) has the molecular formula C15H27N5O2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 6-N-[3-(dimethylamino)propyl]-4-N-(1,1-dioxothiolan-3-yl)-4-N-ethylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[3-(dimethylamino)propyl]-4-N-(1,1-dioxothiolan-3-yl)-4-N-ethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112857759 |
| Molecular Formula | C15H27N5O2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 6-N-[3-(dimethylamino)propyl]-4-N-(1,1-dioxothiolan-3-yl)-4-N-ethylpyrimidine-4,6-diamine |
| SMILES | CCN(c1cc(NCCCN(C)C)ncn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H27N5O2S/c1-4-20(13-6-9-23(21,22)11-13)15-10-14(17-12-18-15)16-7-5-8-19(2)3/h10,12-13H,4-9,11H2,1-3H3,(H,16,17,18) |
| InChIKey | CTESPOIOVYEUAH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|