C18H23N5O — CID 112858448
1-[4-[6-(2,4-dimethylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 112858448) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-[4-[6-(2,4-dimethylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[6-(2,4-dimethylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 112858448 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-[4-[6-(2,4-dimethylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cc(Nc3ccc(C)cc3C)ncn2)CC1 |
| InChI | InChI=1S/C18H23N5O/c1-13-4-5-16(14(2)10-13)21-17-11-18(20-12-19-17)23-8-6-22(7-9-23)15(3)24/h4-5,10-12H,6-9H2,1-3H3,(H,19,20,21) |
| InChIKey | ZYPMMVYYFZFUHC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |