C18H18N4 — CID 112859074
6-N-[(3-methylphenyl)methyl]-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 112859074) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 6-N-[(3-methylphenyl)methyl]-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[(3-methylphenyl)methyl]-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112859074 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 6-N-[(3-methylphenyl)methyl]-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | Cc1cccc(CNc2cc(Nc3ccccc3)ncn2)c1 |
| InChI | InChI=1S/C18H18N4/c1-14-6-5-7-15(10-14)12-19-17-11-18(21-13-20-17)22-16-8-3-2-4-9-16/h2-11,13H,12H2,1H3,(H2,19,20,21,22) |
| InChIKey | HIJVLOADYBLUMC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |